RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1271 |
| Common Name | Nucleoside triphosphate |
| Synonyms Names | C00201 ;NTP ;Nucleoside-Triphosphates |
| Formula | C6H15O13P3; C5H12O13RP3 |
| Formula at pH 7.2 (Predicted) | C5H9O13RP3 |
| Structure |  |
| SMILES | OC1C(OC(CO[P](O)(=O)O[P](O)(=O)O[P](O)(O)=O)C1O)[R]; O=P(O)(O)OP(=O)(O)OP(=O)(O)OCC1(OC([R])C(O)C(O)1) |
| Reactions | OSR0581 OSR0716 OSR1095 OSR1646 OSR2363 |
| Pathways | |
|---|---|
| KEGG | rn00620 rn00710 rn01100 rn01120 rn01110 rn00230 rn00240 |
| Metacyc | PWY-6126 PWY-6125 PPGPPMET-PWY PWY0-166 PWY-6545 PWY-5687 PWY0-163 |
| Database Links | |
|---|---|
| KEGG | C00201 |
| Pubchem Substance | 3501 |