RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1272 |
| Common Name | Orotidine 5'-phosphate |
| Synonyms Names | Orotidylic acid |
| Formula | C10H13N2O11P |
| Formula at pH 7.2 (Predicted) | C10H10N2O11P3- |
| Molecular Weight | 368.191 |
| Structure |  |
| SMILES | c1(=O)([nH]c(=O)n(c(c1)C(O)=O)[CH]2(O[CH]([CH](O)[CH]2O)COP(O)(=O)O)) |
| Reactions | OSR0547 OSR0786 |
| Pathways | |
|---|---|
| KEGG | rn00240 rn01100 |
| Metacyc | PWY0-162 |
| Database Links | |
|---|---|
| KEGG | C01103 |
| ChEBI | 15842 |