RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1273 |
| Common Name | Xanthosine 5'-phosphate |
| Synonyms Names | Xanthylic acid ;XMP ;(9-D-Ribosylxanthine)-5'-phosphate |
| Formula | C10H13N4O9P |
| Formula at pH 7.2 (Predicted) | C10H11N4O9P2- |
| Molecular Weight | 364.205 |
| Structure |  |
| SMILES | C(OP(O)(O)=O)[CH]1(O[CH]([CH](O)[CH]1O)n2(c3(c(nc2)c(=O)[nH]c([nH]3)=O))) |
| Reactions | OSR0634 OSR0784 OSR1583 OSR2038 OSR2772 |
| Pathways | |
|---|---|
| KEGG | rn00230 rn01100 rn01110 |
| Metacyc | DENOVOPURINE2-PWY PWY-5043 PWY-841 URSIN-PWY PWY-5044 P121-PWY |
| Database Links | |
|---|---|
| KEGG | C00655 |
| ChEBI | 15652 |