RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1277 |
| Common Name | Glutathione |
| Synonyms Names | 5-L-Glutamyl-L-cysteinylglycine ;N-(N-gamma-L-Glutamyl-L-cysteinyl)glycine ;gamma-L-Glutamyl-L-cysteinyl-glycine ;GSH ;Reduced glutathione |
| Formula | C10H17N3O6S |
| Formula at pH 7.2 (Predicted) | C10H16N3O6S- |
| Molecular Weight | 307.324 |
| Structure |  |
| SMILES | C(=O)(O)C(N)CCC(=O)NC(CS)C(=O)NCC(O)=O |
| Reactions | OSR0638 OSR0652 OSR0662 OSR0671 OSR0680 OSR0692 OSR0695 OSR0698 OSR0704 OSR0715 OSR0725 OSR0734 OSR0737 OSR0769 OSR0790 OSR0791 OSR0921 OSR0945 OSR0954 OSR0958 OSR0977 OSR0979 OSR0980 OSR0981 OSR0984 OSR1132 OSR1176 OSR1253 OSR1258 OSR1387 OSR1544 OSR1596 OSR1654 OSR2066 OSR2126 OSR2132 OSR2271 OSR2307 OSR2366 OSR2435 OSR2560 OSR2674 |
| Pathways | |
|---|---|
| KEGG | rn00480 rn01100 rn00680 rn01120 rn00980 rn00620 rn00982 rn00053 rn00590 |
| Metacyc | PWY-4202 PWY-4621 PWY-5386 PWY-4041 PWY-4061 PWY-4081 PWY-2261 PWY-6370 GLUTATHIONESYN-PWY GLUT-REDOX-PWY |
| Database Links | |
|---|---|
| KEGG | C00051 |
| ChEBI | 16856 |