RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1283 |
| Common Name | sn-glycero-3-Phosphocholine |
| Synonyms Names | Glycerophosphocholine |
| Formula | C8H21NO6P |
| Formula at pH 7.2 (Predicted) | C8H20NO6P |
| Molecular Weight | 258.229 |
| Structure |  |
| SMILES | C(O)C(O)COP(=O)(O)OCC[N+1](C)(C)C |
| Reactions | OSR0629 OSR0681 |
| Pathways | |
|---|---|
| KEGG | rn00564 |
| Database Links | |
|---|---|
| KEGG | C00670 |
| ChEBI | 16870 |