RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1284 |
| Common Name | D-4'-Phosphopantothenate |
| Synonyms Names | (R)-4'-Phosphopantothenate |
| Formula | C9H18NO8P |
| Formula at pH 7.2 (Predicted) | C9H15NO8P3- |
| Molecular Weight | 299.215 |
| Structure |  |
| SMILES | C(OP(O)(=O)O)C(C)(C)C(O)C(=O)NCCC(O)=O |
| Reactions | OSR1388 OSR1796 OSR1833 |
| Pathways | |
|---|---|
| KEGG | rn00770 rn01100 |
| Metacyc | COA-PWY |
| Database Links | |
|---|---|
| KEGG | C03492 |
| ChEBI | 15905 |