RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1285 |
| Common Name | 6-Thioxanthine 5'-monophosphate |
| Formula | C10H13N4O8PS |
| Formula at pH 7.2 (Predicted) | C10H11N4O8PS2- |
| Molecular Weight | 380.271 |
| Structure |  |
| SMILES | OC1C(O)C(OC1n1cnc2c1[nH]c(=O)[nH]c2=S)COP(=O)(O)O |
| Reactions | OSR2044 OSR2108 |
| Pathways | |
|---|---|
| KEGG | rn00983 |
| Database Links | |
|---|---|
| KEGG | C16618 |
| Pubchem Compound | 3081384 |
| Pubchem Substance | 51090944 |