RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1286 |
| Common Name | R-S-Glutathione |
| Synonyms Names | C02320 ;S-Substituted-Glutathione |
| Formula | C10H16N3O6SR |
| Formula at pH 7.2 (Predicted) | C1H15O6N3SR |
| Structure |  |
| SMILES | NC(CCC(=O)NC(CS[R])C(=O)NCC(O)=O)C(O)=O |
| Reactions | OSR0579 OSR0622 OSR1596 |
| Pathways | |
|---|---|
| KEGG | rn00480 |
| Metacyc | PWY-4061 |
| Database Links | |
|---|---|
| KEGG | C02320 |
| Pubchem Substance | 5373 |