RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1291 |
| Common Name | Abscisic aldehyde |
| Formula | C15H20O3 |
| Formula at pH 7.2 (Predicted) | C15H20O3 |
| Molecular Weight | 248.317 |
| Structure |  |
| SMILES | CC1(C(C(C)=CC(=O)C1)(O)C=CC(C)=CC=O)(C) |
| Reactions | OSR0677 OSR2150 |
| Pathways | |
|---|---|
| KEGG | rn00906 rn01100 rn01110 |
| Metacyc | PWY-2181 |
| Database Links | |
|---|---|
| Gramene | CPD-692 |
| KEGG | C13455 |
| ChEBI | 31157 |
| Pubchem Compound | 5282224 |
| Pubchem Substance | 586195 |