RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1303 |
| Common Name | GMP |
| Synonyms Names | Guanosine 5'-phosphate ;Guanosine monophosphate ;Guanosine 5'-monophosphate ;Guanylic acid |
| Formula | C10H14N5O8P |
| Formula at pH 7.2 (Predicted) | C10H12N5O8P2- |
| Molecular Weight | 363.221 |
| Structure |  |
| SMILES | C(OP(=O)(O)O)C1(OC(C(O)C1O)n2(c3(c(nc2)c(=O)[nH]c(n3)N))) |
| Reactions | OSR0646 OSR0717 OSR0815 OSR0819 OSR1147 OSR1407 OSR1518 OSR1527 OSR1583 OSR2038 OSR2229 OSR3016 |
| Pathways | |
|---|---|
| KEGG | rn00230 rn01100 |
| Metacyc | P1-PWY PWY-5043 P121-PWY DENOVOPURINE2-PWY PWY-6125 PWY-841 |
| Database Links | |
|---|---|
| KEGG | C00144 |
| ChEBI | 17345 |