RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1304 |
| Common Name | Precursor Z |
| Synonyms Names | Cyclic pyranopterin monophoshate ;cPMP |
| Formula | C10H14N5O8P |
| Formula at pH 7.2 (Predicted) | C10H13N5O8P- |
| Molecular Weight | 363.221 |
| Structure |  |
| SMILES | O=c1nc(N)[nH]c2c1NC1C(N2)OC2C(C1(O)O)OP(=O)(OC2)O |
| Reactions | OSR0823 OSR1580 |
| Pathways | |
|---|---|
| KEGG | rn00790 rn01100 |
| Database Links | |
|---|---|
| KEGG | C18239 |
| ChEBI | 60210 |
| Pubchem Compound | 16061579 |
| Pubchem Substance | 103061421 |