RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1309 |
| Common Name | Molybdopterin |
| Synonyms Names | Pyranopterin ;H2Dtppp-mP |
| Formula | C10H14N5O6PS2 |
| Formula at pH 7.2 (Predicted) | C10H11N5O6PS23- |
| Molecular Weight | 395.352 |
| Structure |  |
| SMILES | SC1=C(S)C2C(OC1COP(=O)(O)O)Nc1c(N2)c(=O)nc([nH]1)N |
| Reactions | OSR1580 OSR2478 |
| Pathways | |
|---|---|
| KEGG | rn00790 rn01100 |
| Database Links | |
|---|---|
| KEGG | C05924 |
| ChEBI | 44074 |
| Pubchem Compound | 444331 |
| Pubchem Substance | 8212 |