RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1310 |
| Common Name | 6-Thioguanosine monophosphate |
| Formula | C10H14N5O7PS |
| Formula at pH 7.2 (Predicted) | C10H12N5O7PS2- |
| Molecular Weight | 379.286 |
| Structure |  |
| SMILES | OC1C(O)C(OC1n1cnc2c1[nH]c(N)nc2=S)COP(=O)(O)O |
| Reactions | OSR2044 |
| Pathways | |
|---|---|
| KEGG | rn00983 |
| Database Links | |
|---|---|
| KEGG | C16619 |
| Pubchem Compound | 3034646 |
| Pubchem Substance | 51090945 |