RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1334 |
| Common Name | Abscisate |
| Synonyms Names | Abscisic acid ;(+)-Abscisic acid ;(+)-abscisate |
| Formula | C15H20O4 |
| Formula at pH 7.2 (Predicted) | C15H19O4- |
| Molecular Weight | 264.317 |
| Structure |  |
| SMILES | CC1(C(C(C)=CC(=O)C1)(O)C=CC(C)=CC(=O)O)(C) |
| Reactions | OSR0677 OSR2809 |
| Pathways | |
|---|---|
| KEGG | rn00906 |
| Metacyc | PWY-5271 |
| Database Links | |
|---|---|
| Gramene | CPD-693 |
| KEGG | C06082 |
| Pubchem Compound | 5280896 |
| Pubchem Substance | 8348 |