RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1337 |
| Common Name | 4-Coumaroylshikimate |
| Synonyms Names | trans-5-O-(4-Coumaroyl)shikimate |
| Formula | C16H16O7 |
| Formula at pH 7.2 (Predicted) | C16H15O7- |
| Molecular Weight | 320.294 |
| Structure |  |
| SMILES | C(=O)(O)C1(CC(C(O)C(C=1)O)OC(=O)C=CC2(=CC=C(O)C=C2)) |
| Reactions | OSR2262 OSR2299 |
| Pathways | |
|---|---|
| KEGG | rn00940 rn00941 rn00945 rn01110 |
| Database Links | |
|---|---|
| Gramene | CPD-412 |
| KEGG | C02947 |
| ChEBI | 16428 |
| Pubchem Compound | 5280555 |
| Pubchem Substance | 5866 |