RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1343 |
| Common Name | saccharopine |
| Formula | C11H20N2O6 |
| Formula at pH 7.2 (Predicted) | C11H19N2O6- |
| Molecular Weight | 276.289 |
| Structure |  |
| SMILES | OC(=O)CCC(C(=O)O)NCCCCC(C(=O)O)N |
| Reactions | OSR2187 OSR2191 OSR2251 OSR2254 |
| Pathways | |
|---|---|
| Metacyc | LYSINE-DEG1-PWY |