RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1349 |
| Common Name | inositol pentakisphosphate |
| Formula | C6H7O21P5 |
| Formula at pH 7.2 (Predicted) | C6H7O21P510- |
| Structure |  |
| SMILES | O=P([O-])([O-])O[C@@H]1[C@@H](OP([O-])([O-])=O)[C@H](OP([O-])([O-])=O)[C@H](O)[C@H](OP([O-])([O-])=O)[C@H]1OP([O-])([O-])=O |
| Reactions | OSR1489 OSR1573 |
| Pathways | |
|---|---|
| KEGG | rn00562 |
| Metacyc | PWY-6361 PWY-6554 PWY-6366 |