RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1351 |
| Common Name | S-Formylglutathione |
| Formula | C11H17N3O7S |
| Formula at pH 7.2 (Predicted) | C11H16N3O7S- |
| Molecular Weight | 335.334 |
| Structure |  |
| SMILES | C(CCC(N)C(=O)O)(=O)NC(CS[CH]=O)C(=O)NCC(=O)O |
| Reactions | OSR0662 OSR2171 OSR2239 OSR2249 |
| Pathways | |
|---|---|
| KEGG | rn00680 rn01120 |
| Metacyc | PWY-1801 |
| Database Links | |
|---|---|
| Gramene | CPD-548 |
| KEGG | C01031 |
| ChEBI | 16225 |