RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1353 |
| Common Name | 1-(2-Carboxyphenylamino)-1-deoxy-D-ribulose 5-phosphate |
| Formula | C12H16NO9P |
| Formula at pH 7.2 (Predicted) | C12H13NO9P3- |
| Molecular Weight | 349.231 |
| Structure |  |
| SMILES | C(OP(O)(O)=O)C(O)C(O)C(=O)CNc1(c(C(O)=O)cccc1) |
| Reactions | OSR0588 OSR0605 |
| Pathways | |
|---|---|
| KEGG | rn00400 rn01100 rn01110 |
| Metacyc | TRPSYN-PWY |
| Database Links | |
|---|---|
| KEGG | C01302 |
| ChEBI | 29112 |