RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1360 |
| Common Name | 1-Lysolecithin |
| Synonyms Names | 3-Lysolecithin ;1-Lysophosphatidylcholine ;2-Acylglycero-3-phosphocholine ;2-Acyl-sn-glycero-3-phosphocholine ;C04233 ;2-Acylglycero-Phosphocholines |
| Formula | C9H20NO7PR |
| Formula at pH 7.2 (Predicted) | C9H19NO7PR |
| Structure |  |
| SMILES | C[N+](C)(C)CCO[P](O)(=O)OCC(CO)OC(=O)[R] |
| Reactions | OSR0681 OSR0705 |
| Pathways | |
|---|---|
| KEGG | rn00564 |
| Metacyc | LIPASYN-PWY |
| Database Links | |
|---|---|
| KEGG | C04233 |
| Pubchem Substance | 6902 |