RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1361 |
| Common Name | 2-Lysolecithin |
| Synonyms Names | 2-Lysophosphatidylcholine ;1-Acylglycerophosphocholine ;alpha-Acylglycerophosphocholine ;1-acyl-sn-glycero-3-phosphocholine ;1-Acyl-sn-glycerol-3-phosphocholine ;C04230 ;1-Acylglycero-Phosphocholines |
| Formula | C9H20NO7PR; C8H20NO6PR |
| Formula at pH 7.2 (Predicted) | C9H19NO7PR |
| Structure |  |
| SMILES | C[N+](C)(C)CCO[P](O)(=O)OCC(O)COC(=O)[R]; C[N+](C)(C)CCO[P](O)(=O)OCC(O)CO[R] |
| Reactions | OSR0673 OSR0701 OSR1091 OSR1119 OSR1138 OSR1695 OSR2321 |
| Pathways | |
|---|---|
| KEGG | rn00564 rn00592 rn01100 rn00591 rn00590 |
| Metacyc | LIPASYN-PWY PWY-735 |
| Database Links | |
|---|---|
| KEGG | C04230 |
| Pubchem Substance | 6900 |