RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1368 |
| Common Name | Xanthoxin |
| Synonyms Names | 2-cis,4-trans-Xanthoxin ;xanthoxin |
| Formula | C15H22O3;C15H20O3 |
| Formula at pH 7.2 (Predicted) | C15H22O3 |
| Molecular Weight | 250.333 |
| Structure |  |
| SMILES | CC(=CC=O)C=CC12C(CC(CC1(O2)C)O)(C)C;O=CC=C(C=CC12OC2(C)CC(=O)CC1(C)C)C |
| Reactions | OSR1932 OSR1939 OSR1941 OSR2150 OSR2280 |
| Pathways | |
|---|---|
| KEGG | rn00906 rn01110 rn01100 |
| Metacyc | PWY-695 PWY-2181 |
| Database Links | |
|---|---|
| Gramene | CPD-7279 |
| KEGG | C13453 |
| ChEBI | 32304 |
| Pubchem Compound | 5282222 |
| Pubchem Substance | 586193 |