RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1376 |
| Common Name | dIDP |
| Synonyms Names | 2'-Deoxyinosine-5'-diphosphate ;2'-Deoxyinosine 5'-diphosphate |
| Formula | C10H14N4O10P2 |
| Formula at pH 7.2 (Predicted) | C10H11N4O10P23- |
| Molecular Weight | 412.187 |
| Structure |  |
| SMILES | OC1CC(OC1COP(=O)(OP(=O)(O)O)O)n1cnc2c1[nH]cnc2=O |
| Reactions | OSR1546 |
| Pathways | |
|---|---|
| KEGG | rn00230 |
| Database Links | |
|---|---|
| KEGG | C01344 |
| ChEBI | 28823 |
| Pubchem Compound | 439488 |
| Pubchem Substance | 4549 |