RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1378 |
| Common Name | Pantetheine |
| Synonyms Names | (R)-Pantetheine |
| Formula | C11H22N2O4S |
| Formula at pH 7.2 (Predicted) | C11H22N2O4S |
| Molecular Weight | 278.368 |
| Structure |  |
| SMILES | SCCNC(=O)CCNC(=O)C(C(CO)(C)C)O |
| Reactions | OSR1545 |
| Pathways | |
|---|---|
| KEGG | rn00770 |
| Database Links | |
|---|---|
| KEGG | C00831 |
| ChEBI | 16753 |
| Pubchem Compound | 439322 |
| Pubchem Substance | 4089 |