RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1379 |
| Common Name | CDP |
| Synonyms Names | Cytidine 5'-diphosphate ;Cytidine diphosphate |
| Formula | C9H15N3O11P2 |
| Formula at pH 7.2 (Predicted) | C9H13N3O11P22- |
| Molecular Weight | 403.176 |
| Structure |  |
| SMILES | NC1=NC(=O)N(C=C1)C2OC(CO[P](O)(=O)O[P](O)(O)=O)C(O)C2O |
| Reactions | OSR0674 OSR0743 OSR1260 OSR1369 OSR1453 OSR1540 OSR1627 OSR1988 OSR2512 OSR2516 OSR3018 |
| Pathways | |
|---|---|
| KEGG | rn00240 rn00052 rn01100 rn00500 rn00510 |
| Metacyc | PWY0-162 PWY0-163 PWY-3821 SUCSYN-PWY PWY-621 PWY-3801 |
| Database Links | |
|---|---|
| KEGG | C00112 |
| ChEBI | 17239 |