RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1380 |
| Common Name | 5-Amino-6-(5'-phospho-D-ribitylamino)uracil |
| Synonyms Names | 5-Amino-2,6-dioxy-4-(5'-phospho-D-ribitylamino)pyrimidine ;5-Amino-6-(5-phospho-D-ribitylamino)uracil |
| Formula | C9H17N4O9P |
| Formula at pH 7.2 (Predicted) | C9H15N4O9P2- |
| Molecular Weight | 356.226 |
| Structure |  |
| SMILES | C(C(O)C(O)C(O)COP(O)(O)=O)Nc1(c(N)c(=O)[nH]c([nH]1)=O) |
| Reactions | OSR0678 OSR2237 |
| Pathways | |
|---|---|
| KEGG | rn00740 rn01100 |
| Metacyc | RIBOSYN2-PWY |
| Database Links | |
|---|---|
| Gramene | CPD-1086 |
| KEGG | C04454 |
| ChEBI | 18247 |