RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1381 |
| Common Name | Phosphatidylcholine |
| Synonyms Names | Choline phosphatide ;LECITHIN ;3-sn-Phosphatidylcholine ;Phosphatidyl-N-trimethylethanolamine ;1,2-Diacyl-sn-glycero-3-phosphocholine ;C00157 ;8002-43-5 ;PHOSPHATIDYLCHOLINE |
| Formula | C10H18NO8PR2 |
| Formula at pH 7.2 (Predicted) | C1H18O8N1P1R2- |
| Structure |  |
| SMILES | C[N+](C)(C)CCO[P]([O-])(=O)OCC(COC(=O)[R])OC(=O)[R] |
| Reactions | OSR0673 OSR0682 OSR0683 OSR0701 OSR0705 OSR0991 OSR1091 OSR1119 OSR1138 OSR1287 OSR1695 OSR1722 OSR2321 |
| Pathways | |
|---|---|
| KEGG | rn00564 rn00592 rn01100 rn00591 rn00590 |
| Metacyc | LIPASYN-PWY PWY-735 |
| Database Links | |
|---|---|
| KEGG | C00157 C00157 |
| Pubchem Substance | 3457 |