RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1382 |
| Common Name | Thiamin monophosphate |
| Synonyms Names | Thiamine monophosphate ;Thiamin phosphate ;Thiamine phosphate ;TMP |
| Formula | C12H18N4O4PS |
| Formula at pH 7.2 (Predicted) | C12H16N4O4PS- |
| Molecular Weight | 345.334 |
| Structure |  |
| SMILES | c1(c(cnc(n1)C)C[n+1]2(c(C)c(sc2)CCOP(=O)(O)O))(N) |
| Reactions | OSR0878 OSR1445 OSR1556 |
| Pathways | |
|---|---|
| KEGG | rn00730 rn01100 |
| Metacyc | THISYN-PWY |
| Database Links | |
|---|---|
| KEGG | C01081 |
| ChEBI | 9533 |