RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1383 |
| Common Name | S-Succinyldihydrolipoamide-E |
| Synonyms Names | C16254 ;[Dihydrolipoyllysine-residue succinyltransferase] S-succinyldihydrolipoyllysine |
| Formula | C12H20NO4S2R |
| Formula at pH 7.2 (Predicted) | C12H19NO4S2R |
| Structure |  |
| SMILES | N(C(=O)CCCCC(S)CCSC(=O)CCC(O)=O)[R] |
| Reactions | OSR1494 OSR2303 |
| Pathways | |
|---|---|
| KEGG | rn00020 rn01120 rn01100 rn01110 |
| Database Links | |
|---|---|
| KEGG | C16254 |
| Pubchem Substance | 47205562 |