RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1385 |
| Common Name | all-trans-Polyprenyl diphosphate |
| Synonyms Names | Polyisopentenylpyrophosphate ;Polyisopentenyldiphosphate ;trans-Polyisopentenyldiphosphate ;Polyprenyl diphosphate |
| Formula | C5H12O7P2(C5H8)n |
| Formula at pH 7.2 (Predicted) | C10H18O7P22- |
| Structure |  |
| SMILES | CC(=CCOP(=O)(OP(=O)(O)O)O)CCC=C(C)C |
| Reactions | OSR0948 |
| Pathways | |
|---|---|
| KEGG | rn00130 rn01100 rn01110 |
| Database Links | |
|---|---|
| KEGG | C05847 |
| ChEBI | 55337 |
| Pubchem Compound | 445995 |
| Pubchem Substance | 8140 |