RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1386 |
| Common Name | cis-beta-D-Glucosyl-2-hydroxycinnamate |
| Synonyms Names | beta-D-Glucosyl-2-coumarinate |
| Formula | C15H18O8 |
| Formula at pH 7.2 (Predicted) | C15H17O8- |
| Molecular Weight | 326.299 |
| Structure |  |
| SMILES | C1(C(O)C(O)C(O)C(O1)CO)Oc2(c(C=CC(O)=O)cccc2) |
| Reactions | OSR0651 OSR0687 |
| Pathways | |
|---|---|
| KEGG | rn00940 rn01110 |
| Metacyc | PWY-5176 |
| Database Links | |
|---|---|
| Gramene | CPD-7417 |
| KEGG | C05839 |
| Pubchem Compound | 5316113 |
| Pubchem Substance | 8132 |