RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1389 |
| Common Name | 4-methylumbelliferyl-beta-D-glucuronide |
| Formula | C16H16O9 |
| Formula at pH 7.2 (Predicted) | C16H15O9- |
| Structure |  |
| SMILES | CC1=CC(=O)OC2=CC(=CC=C12)OC3OC(C(O)C(O)C3O)C(O)=O |
| Reactions | OSR0684 |
| Pathways | |
|---|---|
| KEGG | rn00983 rn00944 rn00531 rn01100 rn00040 rn00860 rn00500 |
| Metacyc | GLUCUROCAT-PWY |