RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1390 |
| Common Name | 6,7-Dimethyl-8-(1-D-ribityl)lumazine |
| Formula | C13H18N4O6 |
| Formula at pH 7.2 (Predicted) | C13H17N4O6- |
| Molecular Weight | 326.305 |
| Structure |  |
| SMILES | CC1(N(CC(O)C(O)C(O)CO)C2(C(=NC(C)=1)C(=O)NC(N=2)=O)) |
| Reactions | OSR0899 OSR2129 |
| Pathways | |
|---|---|
| KEGG | rn00740 rn01100 |
| Metacyc | RIBOSYN2-PWY |
| Database Links | |
|---|---|
| KEGG | C04332 |
| ChEBI | 17601 |