RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1392 |
| Common Name | IDP |
| Synonyms Names | Inosine 5'-diphosphate ;Inosine diphosphate |
| Formula | C10H14N4O11P2 |
| Formula at pH 7.2 (Predicted) | C10H11N4O11P23- |
| Molecular Weight | 428.186 |
| Structure |  |
| SMILES | OC1C(COP(=O)(OP(=O)(O)O)O)OC(C1O)n1cnc2c1[nH]cnc2=O |
| Reactions | OSR0690 OSR0763 OSR1293 OSR1302 OSR1314 OSR1578 OSR1993 OSR2535 |
| Pathways | |
|---|---|
| KEGG | rn00230 rn00052 rn01100 rn00240 rn00500 rn00020 rn01110 rn01120 |
| Metacyc | PWY-3821 SUCSYN-PWY PWY-621 PWY-3801 |
| Database Links | |
|---|---|
| KEGG | C00104 |
| ChEBI | 17808 |
| Pubchem Compound | 6831 |
| Pubchem Substance | 3404 |