RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1394 |
| Common Name | dTDP |
| Synonyms Names | Deoxythymidine 5'-diphosphate |
| Formula | C10H16N2O11P2 |
| Formula at pH 7.2 (Predicted) | C10H14N2O11P22- |
| Molecular Weight | 402.188 |
| Structure |  |
| SMILES | Cc1(cn(c(=O)[nH]c1=O)C2(OC(C(C2)O)COP(=O)(O)OP(O)(O)=O)) |
| Reactions | OSR0693 OSR0762 OSR1284 OSR1328 OSR1464 OSR1582 |
| Pathways | |
|---|---|
| KEGG | rn00240 rn01100 |
| Metacyc | PWY0-166 P1-PWY |
| Database Links | |
|---|---|
| KEGG | C00363 |
| ChEBI | 18075 |