RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1400 |
| Common Name | Adenylylselenate |
| Synonyms Names | Adenosine-5'-phosphoselenate |
| Formula | C10H14N5O10PSe |
| Formula at pH 7.2 (Predicted) | C10H13N5O10PSe- |
| Molecular Weight | 474.179 |
| Structure |  |
| SMILES | OC1C(COP(=O)(O[Se](=O)(=O)O)O)OC(C1O)n1cnc2c1ncnc2N |
| Reactions | OSR0909 OSR1589 |
| Pathways | |
|---|---|
| KEGG | rn00450 |
| Database Links | |
|---|---|
| KEGG | C05686 |
| Pubchem Compound | 440758 |
| Pubchem Substance | 7993 |