RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1411 |
| Common Name | p-nitrophenyl-N-acetyl-beta-D-galactosaminide |
| Formula | C14H18N2O8 |
| Formula at pH 7.2 (Predicted) | C14H18N2O8 |
| Structure |  |
| SMILES | CC(=O)NC1C(O)C(O)C(CO)OC1OC2=CC=C(C=C2)[N+]([O-])=O |
| Reactions | OSR0706 |
| Pathways | |
|---|---|
| KEGG | rn00520 rn00531 rn00604 rn00603 rn01100 rn00511 rn00513 |
| Metacyc | PWY-6573 PWY-6576 |