RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1420 |
| Common Name | SQDG |
| Synonyms Names | Sulfoquinovosyldiacylglycerol ;C13508 ;1,2-Diacyl-3-(6-sulfo-alpha-D-quinovosyl)-sn-glycerol ;sulfoquinovosyldiacylglycerol |
| Formula | C11H16O12SR2 |
| Formula at pH 7.2 (Predicted) | C11H15O12SR2 |
| Structure |  |
| SMILES | OC1C(O)C(C[S](O)(=O)=O)OC(OCC(COC(=O)[R])OC(=O)[R])C1O |
| Reactions | OSR1428 OSR1435 |
| Pathways | |
|---|---|
| KEGG | rn00561 rn01100 |
| Metacyc | PWY-401 |
| Database Links | |
|---|---|
| KEGG | C13508 |
| Pubchem Compound | 448048 |
| Pubchem Substance | 586228 |