RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1421 |
| Common Name | Acetyl adenylate |
| Synonyms Names | 5'-Acetylphosphoadenosine |
| Formula | C12H16N5O8P |
| Formula at pH 7.2 (Predicted) | C12H15N5O8P- |
| Molecular Weight | 389.258 |
| Structure |  |
| SMILES | CC(=O)OP(=O)(OCC1OC(C(C1O)O)n1cnc2c1ncnc2N)O |
| Reactions | OSR0927 OSR2339 |
| Pathways | |
|---|---|
| KEGG | rn00620 |
| Database Links | |
|---|---|
| KEGG | C05993 |
| ChEBI | 37666 |
| Pubchem Compound | 440867 |
| Pubchem Substance | 8267 |