RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1423 |
| Common Name | Glutathione episulfonium ion |
| Formula | C12H20N3O6S |
| Formula at pH 7.2 (Predicted) | C12H19N3O6S |
| Molecular Weight | 334.369 |
| Structure |  |
| SMILES | O=C(NC(C(=O)NCC(=O)O)C[S+]1CC1)CCC(C(=O)O)N |
| Reactions | OSR0715 |
| Pathways | |
|---|---|
| KEGG | rn00980 |
| Database Links | |
|---|---|
| KEGG | C14874 |
| Pubchem Compound | 159079 |
| Pubchem Substance | 17395872 |