RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1432 |
| Common Name | Chlorogenate |
| Synonyms Names | Chlorogenic acid ;Caffeoyl quinic acid ;trans-5-O-Caffeoyl-D-quinate |
| Formula | C16H18O9 |
| Formula at pH 7.2 (Predicted) | C16H17O9- |
| Molecular Weight | 354.309 |
| Structure |  |
| SMILES | C(=O)(OC1(C(O)C(O)CC(O)(C1)C(O)=O))C=Cc2(cc(O)c(O)cc2) |
| Reactions | OSR2296 OSR2355 |
| Pathways | |
|---|---|
| KEGG | rn00940 rn00941 rn00945 rn01110 |
| Database Links | |
|---|---|
| KEGG | C00852 |
| ChEBI | 16112 |
| Pubchem Compound | 1794427 |
| Pubchem Substance | 4109 |