RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1438 |
| Common Name | indole-3-acetyl-beta-1-D-glucose |
| Formula | C16H19N1O7 |
| Formula at pH 7.2 (Predicted) | C16H19NO7 |
| Molecular Weight | 337.329 |
| Structure |  |
| SMILES | OCC1OC(OC(=O)Cc2c[nH]c3c2cccc3)C(C(C1O)O)O |
| Reactions | OSR1122 OSR1448 |
| Pathways | |
|---|---|
| Metacyc | PWY-1741 PWY-1782 |
| Database Links | |
|---|---|
| Gramene | CPD-1102 |