RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1442 |
| Common Name | 2-Polyprenyl-6-methoxy-1,4-benzoquinone |
| Formula | C12H14O3(C5H8)n |
| Formula at pH 7.2 (Predicted) | C17H22O3 |
| Structure |  |
| SMILES | COC1=CC(=O)C=C(C1=O)CC=C(CCC=C(C)C)C |
| Reactions | OSR0723 OSR1691 |
| Pathways | |
|---|---|
| KEGG | rn00130 rn01100 rn01110 |
| Database Links | |
|---|---|
| KEGG | C17560 |
| Pubchem Compound | 21587070 |
| Pubchem Substance | 96023905 |