RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1444 |
| Common Name | N-((R)-Pantothenoyl)-L-cysteine |
| Synonyms Names | D-Pantothenoyl-L-cysteine ;N-Pantothenoylcysteine |
| Formula | C12H22N2O6S |
| Formula at pH 7.2 (Predicted) | C12H21N2O6S- |
| Molecular Weight | 322.378 |
| Structure |  |
| SMILES | SCC(C(=O)O)NC(=O)CCNC(=O)C(C(CO)(C)C)O |
| Reactions | OSR1628 |
| Pathways | |
|---|---|
| KEGG | rn00770 |
| Database Links | |
|---|---|
| KEGG | C04079 |
| ChEBI | 18416 |
| Pubchem Compound | 440217 |
| Pubchem Substance | 6773 |