RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1460 |
| Common Name | Phosphatidylinositol |
| Synonyms Names | 1-Phosphatidyl-myo-inositol ;Phosphatidyl-1D-myo-inositol ;1-Phosphatidyl-D-myo-inositol ;1-Phosphatidyl-1D-myo-inositol ;(3-Phosphatidyl)-1-D-inositol ;1,2-Diacyl-sn-glycero-3-phosphoinositol ;C01194 ;L-1-phosphatidyl-inositols |
| Formula | C11H17O13PR2 |
| Formula at pH 7.2 (Predicted) | C11H16O13PR2 |
| Structure |  |
| SMILES | OC1C(O)C(O)C(O[P](O)(=O)OCC(COC(=O)[R])OC(=O)[R])C(O)C1O |
| Reactions | OSR0731 OSR1392 OSR1659 OSR1662 OSR2094 OSR2319 OSR2373 |
| Pathways | |
|---|---|
| KEGG | rn00562 rn00564 rn01100 rn00563 |
| Metacyc | PHOSLIPSYN2-PWY PWY-6352 PWY-6351 |
| Database Links | |
|---|---|
| KEGG | C01194 |
| Pubchem Substance | 4419 |