RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1462 |
| Common Name | 2-Polyprenyl-6-methoxyphenol |
| Formula | C12H16O2(C5H8)n |
| Formula at pH 7.2 (Predicted) | C17H24O2 |
| Structure |  |
| SMILES | COc1cccc(c1O)CC=C(CCC=C(C)C)C |
| Reactions | OSR0723 |
| Pathways | |
|---|---|
| KEGG | rn00130 rn01100 rn01110 |
| Database Links | |
|---|---|
| KEGG | C17552 |
| Pubchem Compound | 46173939 |
| Pubchem Substance | 96023897 |