RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1469 |
| Common Name | Melibiose |
| Synonyms Names | 6-O-(alpha-D-Galactopyranosyl)-D-glucopyranose ;D-Gal-alpha1->6D-Glucose |
| Formula | C12H22O11 |
| Formula at pH 7.2 (Predicted) | C12H22O11 |
| Molecular Weight | 342.296 |
| Structure |  |
| SMILES | C1(OC(CO)C(O)C(O)C(O)1)OCC2(C(O)C(O)C(O)C(O)O2) |
| Reactions | OSR0742 OSR0752 OSR1148 OSR1162 |
| Pathways | |
|---|---|
| KEGG | rn00052 rn00561 rn00603 rn00600 |
| Metacyc | PWY0-1301 PWY-6527 |
| Database Links | |
|---|---|
| KEGG | C05402 |
| ChEBI | 28053 |