RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1471 |
| Common Name | Sucrose |
| Synonyms Names | Cane sugar ;Saccharose ;1-alpha-D-Glucopyranosyl-2-beta-D-fructofuranoside |
| Formula | C12H22O11 |
| Formula at pH 7.2 (Predicted) | C12H22O11 |
| Molecular Weight | 342.296 |
| Structure |  |
| SMILES | OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(O)C(O)C1O |
| Reactions | OSR0745 OSR0750 OSR1123 OSR1157 OSR1158 OSR1159 OSR1259 OSR1398 OSR1479 OSR1523 OSR1554 OSR1626 OSR1631 OSR1849 OSR1861 OSR1965 OSR1966 OSR1988 OSR1993 OSR2018 OSR2056 OSR2118 OSR2123 OSR2508 |
| Pathways | |
|---|---|
| KEGG | rn00052 rn01100 rn00500 rn00561 rn00603 rn00600 |
| Metacyc | GLYCOCAT-PWY PWY-842 SUCUTIL-PWY PWY-621 PWY-862 PWY0-1301 PWY-6527 PWY-3821 PWY-3801 SUCSYN-PWY PWY-822 PWY-5337 |
| Database Links | |
|---|---|
| KEGG | C00089 |
| ChEBI | 17992 |