RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1474 |
| Common Name | alpha,alpha-Trehalose |
| Synonyms Names | alpha,alpha'-Trehalose ;Trehalose |
| Formula | C12H22O11 |
| Formula at pH 7.2 (Predicted) | C12H22O11 |
| Molecular Weight | 342.296 |
| Structure |  |
| SMILES | C1(OC(CO)C(O)C(O)C(O)1)OC2(C(O)C(O)C(O)C(O2)CO) |
| Reactions | OSR0541 OSR0888 OSR1351 |
| Pathways | |
|---|---|
| KEGG | rn00500 rn01100 |
| Metacyc | PWY0-1182 TRESYN-PWY PWYG-321 PWY-881 TREHALOSESYN-PWY PWY-2661 |
| Database Links | |
|---|---|
| KEGG | C01083 |
| ChEBI | 16551 |