RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1475 |
| Common Name | Cellobiose |
| Synonyms Names | 1-beta-D-Glucopyranosyl-4-D-glucopyranose |
| Formula | C12H22O11 |
| Formula at pH 7.2 (Predicted) | C12H22O11 |
| Molecular Weight | 342.296 |
| Structure |  |
| SMILES | OCC1OC(OC2C(O)C(O)C(O)OC2CO)C(O)C(O)C1O |
| Reactions | OSR0523 OSR0934 |
| Pathways | |
|---|---|
| KEGG | rn00500 rn01100 rn01110 rn00460 rn00940 |
| Metacyc | PWY-5176 PWY-4441 PWY-3121 PWY-6002 |
| Database Links | |
|---|---|
| KEGG | C00185 |
| ChEBI | 17057 |
| Pubchem Compound | 439178 |
| Pubchem Substance | 3485 |